C13H12N4OS — CID 2966359
6-ethyl-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 2966359) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 6-ethyl-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-ethyl-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 2966359 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 6-ethyl-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCC1=Nc2ccccc2-c2nnc(SC)nc2O1 |
| InChI | InChI=1S/C13H12N4OS/c1-3-10-14-9-7-5-4-6-8(9)11-12(18-10)15-13(19-2)17-16-11/h4-7H,3H2,1-2H3 |
| InChIKey | UIPKHDYTPHFKST-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_67_A(1)', 'substructure': 'N/A'} |
|---|