C24H23ClN2O5 — CID 2966441
4-chloro-N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-oxoethyl]benzamide (PubChem CID 2966441) has the molecular formula C24H23ClN2O5 and a molecular weight of 454.91 g/mol. Its IUPAC name is 4-chloro-N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2966441 |
| Molecular Formula | C24H23ClN2O5 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-chloro-N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(4-methoxyphenyl)-2-oxoethyl]benzamide |
| SMILES | COc1ccc(C(=O)CN(C(=O)c2ccc(Cl)cc2)N2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C24H23ClN2O5/c1-32-18-12-8-15(9-13-18)21(28)14-26(22(29)16-6-10-17(25)11-7-16)27-23(30)19-4-2-3-5-20(19)24(27)31/h6-13,19-20H,2-5,14H2,1H3 |
| InChIKey | SMEWVVFDGMACTD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|