About N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide
N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide (PubChem CID 2966846) has the molecular formula C17H18ClF2NO
and a molecular weight of 325.79 g/mol. Its IUPAC name is N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide |
| PubChem CID | 2966846 |
| Molecular Formula | C17H18ClF2NO |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H18ClF2NO/c18-13-5-15(20)14(19)4-12(13)16(22)21-17-6-9-1-10(7-17)3-11(2-9)8-17/h4-5,9-11H,1-3,6-8H2,(H,21,22) |
| InChIKey | XGOOJJFWBKZNHK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide?
The IUPAC name of N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide (CID 2966846) is N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide.
What is the SMILES notation for N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide?
The canonical SMILES for N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide is O=C(NC12CC3CC(CC(C3)C1)C2)c1cc(F)c(F)cc1Cl.
What is the InChIKey of N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide?
The InChIKey is XGOOJJFWBKZNHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClF2NO/c18-13-5-15(20)14(19)4-12(13)16(22)21-17-6-9-1-10(7-17)3-11(2-9)8-17/h4-5,9-11H,1-3,6-8H2,(H,21,22).
What are the key properties of N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide?
N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide has a molecular weight of 325.79 g/mol, XLogP of 4.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-2-chloro-4,5-difluorobenzamide is sourced from PubChem (CID 2966846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).