About 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride
4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride (PubChem CID 2967205) has the molecular formula C18H29ClN2
and a molecular weight of 308.90 g/mol. Its IUPAC name is 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride |
| PubChem CID | 2967205 |
| Molecular Formula | C18H29ClN2 |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride |
| SMILES | CC(NCc1ccc(N(C)C)cc1)C1CC2CCC1C2.Cl |
| InChI | InChI=1S/C18H28N2.ClH/c1-13(18-11-15-4-7-16(18)10-15)19-12-14-5-8-17(9-6-14)20(2)3;/h5-6,8-9,13,15-16,18-19H,4,7,10-12H2,1-3H3;1H |
| InChIKey | KQSHGAPFFDCYEV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
The IUPAC name of 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride (CID 2967205) is 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride.
What is the SMILES notation for 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
The canonical SMILES for 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride is CC(NCc1ccc(N(C)C)cc1)C1CC2CCC1C2.Cl.
What is the InChIKey of 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
The InChIKey is KQSHGAPFFDCYEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2.ClH/c1-13(18-11-15-4-7-16(18)10-15)19-12-14-5-8-17(9-6-14)20(2)3;/h5-6,8-9,13,15-16,18-19H,4,7,10-12H2,1-3H3;1H.
What are the key properties of 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride has a molecular weight of 308.90 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride is sourced from PubChem (CID 2967205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).