About 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride
4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride (PubChem CID 2967317) has the molecular formula C13H15ClN4O2
and a molecular weight of 294.74 g/mol. Its IUPAC name is 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride |
| PubChem CID | 2967317 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride |
| SMILES | Cc1cc(C)nc(Nc2cc([N+](=O)[O-])ccc2C)n1.Cl |
| InChI | InChI=1S/C13H14N4O2.ClH/c1-8-4-5-11(17(18)19)7-12(8)16-13-14-9(2)6-10(3)15-13;/h4-7H,1-3H3,(H,14,15,16);1H |
| InChIKey | NAXIZACSAGNBPZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride?
The IUPAC name of 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride (CID 2967317) is 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride.
What is the SMILES notation for 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride?
The canonical SMILES for 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride is Cc1cc(C)nc(Nc2cc([N+](=O)[O-])ccc2C)n1.Cl.
What is the InChIKey of 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride?
The InChIKey is NAXIZACSAGNBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2.ClH/c1-8-4-5-11(17(18)19)7-12(8)16-13-14-9(2)6-10(3)15-13;/h4-7H,1-3H3,(H,14,15,16);1H.
What are the key properties of 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride?
4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride has a molecular weight of 294.74 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-N-(2-methyl-5-nitrophenyl)pyrimidin-2-amine;hydrochloride is sourced from PubChem (CID 2967317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).