About 2-iodo-10H-acridin-9-one
2-iodo-10H-acridin-9-one (PubChem CID 2967426) has the molecular formula C13H8INO
and a molecular weight of 321.12 g/mol. Its IUPAC name is 2-iodo-10H-acridin-9-one.
Molecular Properties
| Compound Name | 2-iodo-10H-acridin-9-one |
| PubChem CID | 2967426 |
| Molecular Formula | C13H8INO |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 2-iodo-10H-acridin-9-one |
| SMILES | O=c1c2ccccc2[nH]c2ccc(I)cc12 |
| InChI | InChI=1S/C13H8INO/c14-8-5-6-12-10(7-8)13(16)9-3-1-2-4-11(9)15-12/h1-7H,(H,15,16) |
| InChIKey | XETGIKUBHYTPOH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-10H-acridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-10H-acridin-9-one?
The IUPAC name of 2-iodo-10H-acridin-9-one (CID 2967426) is 2-iodo-10H-acridin-9-one.
What is the SMILES notation for 2-iodo-10H-acridin-9-one?
The canonical SMILES for 2-iodo-10H-acridin-9-one is O=c1c2ccccc2[nH]c2ccc(I)cc12.
What is the InChIKey of 2-iodo-10H-acridin-9-one?
The InChIKey is XETGIKUBHYTPOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8INO/c14-8-5-6-12-10(7-8)13(16)9-3-1-2-4-11(9)15-12/h1-7H,(H,15,16).
What are the key properties of 2-iodo-10H-acridin-9-one?
2-iodo-10H-acridin-9-one has a molecular weight of 321.12 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-10H-acridin-9-one is sourced from PubChem (CID 2967426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).