C15H19N3O4 — CID 2967805
ethyl 2-[3-oxo-1-(phenylcarbamoyl)piperazin-2-yl]acetate (PubChem CID 2967805) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl 2-[3-oxo-1-(phenylcarbamoyl)piperazin-2-yl]acetate.
| Compound Name | ethyl 2-[3-oxo-1-(phenylcarbamoyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 2967805 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | ethyl 2-[3-oxo-1-(phenylcarbamoyl)piperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(=O)NCCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H19N3O4/c1-2-22-13(19)10-12-14(20)16-8-9-18(12)15(21)17-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | VLESEFXDRIVONG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |