C21H28N4OS — CID 2968707
1-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-3-(4-methylsulfanylphenyl)urea (PubChem CID 2968707) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-3-(4-methylsulfanylphenyl)urea.
| Compound Name | 1-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-3-(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 2968707 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]-3-(4-methylsulfanylphenyl)urea |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)Nc3ccc(SC)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H28N4OS/c1-3-24-12-14-25(15-13-24)16-17-4-6-18(7-5-17)22-21(26)23-19-8-10-20(27-2)11-9-19/h4-11H,3,12-16H2,1-2H3,(H2,22,23,26) |
| InChIKey | ZJFSABJXHDOCEH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |