About benzyl(triethyl)azanium thiocyanate
benzyl(triethyl)azanium thiocyanate (PubChem CID 29689) has the molecular formula C14H22N2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is benzyl(triethyl)azanium thiocyanate.
Molecular Properties
| Compound Name | benzyl(triethyl)azanium thiocyanate |
| PubChem CID | 29689 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | benzyl(triethyl)azanium thiocyanate |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.N#C[S-] |
| InChI | InChI=1S/C13H22N.CHNS/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;2-1-3/h7-11H,4-6,12H2,1-3H3;3H/q+1;/p-1 |
| InChIKey | DBYIPBJRDWQOHF-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triethyl)azanium thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triethyl)azanium thiocyanate?
The IUPAC name of benzyl(triethyl)azanium thiocyanate (CID 29689) is benzyl(triethyl)azanium thiocyanate.
What is the SMILES notation for benzyl(triethyl)azanium thiocyanate?
The canonical SMILES for benzyl(triethyl)azanium thiocyanate is CC[N+](CC)(CC)Cc1ccccc1.N#C[S-].
What is the InChIKey of benzyl(triethyl)azanium thiocyanate?
The InChIKey is DBYIPBJRDWQOHF-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H22N.CHNS/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;2-1-3/h7-11H,4-6,12H2,1-3H3;3H/q+1;/p-1.
What are the key properties of benzyl(triethyl)azanium thiocyanate?
benzyl(triethyl)azanium thiocyanate has a molecular weight of 250.41 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triethyl)azanium thiocyanate is sourced from PubChem (CID 29689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).