About 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine
5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 2968945) has the molecular formula C10H13N3S
and a molecular weight of 207.30 g/mol. Its IUPAC name is 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 2968945 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Cc1cccnc1NC1=NCC(C)S1 |
| InChI | InChI=1S/C10H13N3S/c1-7-4-3-5-11-9(7)13-10-12-6-8(2)14-10/h3-5,8H,6H2,1-2H3,(H,11,12,13) |
| InChIKey | RNZQWONLQDAXRL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine (CID 2968945) is 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine is Cc1cccnc1NC1=NCC(C)S1.
What is the InChIKey of 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is RNZQWONLQDAXRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S/c1-7-4-3-5-11-9(7)13-10-12-6-8(2)14-10/h3-5,8H,6H2,1-2H3,(H,11,12,13).
What are the key properties of 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine?
5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 207.30 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(3-methyl-2-pyridinyl)-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 2968945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).