C18H32N2S2 — CID 29693
benzyl(triethyl)azanium;N,N-diethylcarbamodithioate (PubChem CID 29693) has the molecular formula C18H32N2S2 and a molecular weight of 340.60 g/mol. Its IUPAC name is benzyl(triethyl)azanium;N,N-diethylcarbamodithioate.
| Compound Name | benzyl(triethyl)azanium;N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 29693 |
| Molecular Formula | C18H32N2S2 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | benzyl(triethyl)azanium;N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)[S-].CC[N+](CC)(CC)Cc1ccccc1 |
| InChI | InChI=1S/C13H22N.C5H11NS2/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;1-3-6(4-2)5(7)8/h7-11H,4-6,12H2,1-3H3;3-4H2,1-2H3,(H,7,8)/q+1;/p-1 |
| InChIKey | MTEQFQLDZYXTDV-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|