About N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline (PubChem CID 2969440) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline |
| PubChem CID | 2969440 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline |
| SMILES | Cc1cccn2cc(CNc3ccccc3)nc12 |
| InChI | InChI=1S/C15H15N3/c1-12-6-5-9-18-11-14(17-15(12)18)10-16-13-7-3-2-4-8-13/h2-9,11,16H,10H2,1H3 |
| InChIKey | VRFFRUWZLFHPAD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
The IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline (CID 2969440) is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline.
What is the SMILES notation for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
The canonical SMILES for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline is Cc1cccn2cc(CNc3ccccc3)nc12.
What is the InChIKey of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
The InChIKey is VRFFRUWZLFHPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3/c1-12-6-5-9-18-11-14(17-15(12)18)10-16-13-7-3-2-4-8-13/h2-9,11,16H,10H2,1H3.
What are the key properties of N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline?
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline has a molecular weight of 237.31 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]aniline is sourced from PubChem (CID 2969440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).