C25H20N2O6 — CID 2969704
ethyl 2-amino-2',4'-dioxo-1'-prop-2-enylspiro[chromene-4,3'-chromeno[4,3-b]pyrrole]-3-carboxylate (PubChem CID 2969704) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is ethyl 2-amino-2',4'-dioxo-1'-prop-2-enylspiro[chromene-4,3'-chromeno[4,3-b]pyrrole]-3-carboxylate.
| Compound Name | ethyl 2-amino-2',4'-dioxo-1'-prop-2-enylspiro[chromene-4,3'-chromeno[4,3-b]pyrrole]-3-carboxylate |
|---|---|
| PubChem CID | 2969704 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | ethyl 2-amino-2',4'-dioxo-1'-prop-2-enylspiro[chromene-4,3'-chromeno[4,3-b]pyrrole]-3-carboxylate |
| SMILES | C=CCN1C(=O)C2(C(C(=O)OCC)=C(N)Oc3ccccc32)c2c1c1ccccc1oc2=O |
| InChI | InChI=1S/C25H20N2O6/c1-3-13-27-20-14-9-5-7-11-16(14)33-23(29)18(20)25(24(27)30)15-10-6-8-12-17(15)32-21(26)19(25)22(28)31-4-2/h3,5-12H,1,4,13,26H2,2H3 |
| InChIKey | CEAKLTKTWVZFQW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|