C15H20N4OS — CID 2969796
1-(4-ethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 2969796) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 2969796 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C15H20N4OS/c1-2-20-14-6-4-13(5-7-14)18-15(21)17-8-3-10-19-11-9-16-12-19/h4-7,9,11-12H,2-3,8,10H2,1H3,(H2,17,18,21) |
| InChIKey | NWNREZFTOBJNEO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|