C10H12F6N4O — CID 2969946
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea (PubChem CID 2969946) has the molecular formula C10H12F6N4O and a molecular weight of 318.22 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 2969946 |
| Molecular Formula | C10H12F6N4O |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(3-imidazol-1-ylpropyl)urea |
| SMILES | O=C(NCCCn1ccnc1)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6N4O/c11-9(12,13)7(10(14,15)16)19-8(21)18-2-1-4-20-5-3-17-6-20/h3,5-7H,1-2,4H2,(H2,18,19,21) |
| InChIKey | XFPBTRXRMAUCAD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|