C22H17N3O2 — CID 2970023
2,3-bis(4-methylphenyl)-6-nitroquinoxaline (PubChem CID 2970023) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 2,3-bis(4-methylphenyl)-6-nitroquinoxaline.
| Compound Name | 2,3-bis(4-methylphenyl)-6-nitroquinoxaline |
|---|---|
| PubChem CID | 2970023 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2,3-bis(4-methylphenyl)-6-nitroquinoxaline |
| SMILES | Cc1ccc(-c2nc3ccc([N+](=O)[O-])cc3nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H17N3O2/c1-14-3-7-16(8-4-14)21-22(17-9-5-15(2)6-10-17)24-20-13-18(25(26)27)11-12-19(20)23-21/h3-13H,1-2H3 |
| InChIKey | RKLRTDQKICXLGM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|