About 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide
3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide (PubChem CID 2970406) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide |
| PubChem CID | 2970406 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NC(C)C1CCCO1 |
| InChI | InChI=1S/C12H18N2O3/c1-7(10-5-4-6-16-10)13-12(15)11-8(2)14-17-9(11)3/h7,10H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | JYVXTLDEXZYELT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide?
The IUPAC name of 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide (CID 2970406) is 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide is Cc1noc(C)c1C(=O)NC(C)C1CCCO1.
What is the InChIKey of 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide?
The InChIKey is JYVXTLDEXZYELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-7(10-5-4-6-16-10)13-12(15)11-8(2)14-17-9(11)3/h7,10H,4-6H2,1-3H3,(H,13,15).
What are the key properties of 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide?
3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide has a molecular weight of 238.29 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-[1-(oxolan-2-yl)ethyl]-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 2970406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).