C15H13ClFN3OS — CID 2970626
3-chloro-4-fluoro-N-(3-imidazol-1-ylpropyl)-1-benzothiophene-2-carboxamide (PubChem CID 2970626) has the molecular formula C15H13ClFN3OS and a molecular weight of 337.81 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(3-imidazol-1-ylpropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-4-fluoro-N-(3-imidazol-1-ylpropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2970626 |
| Molecular Formula | C15H13ClFN3OS |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-chloro-4-fluoro-N-(3-imidazol-1-ylpropyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1sc2cccc(F)c2c1Cl |
| InChI | InChI=1S/C15H13ClFN3OS/c16-13-12-10(17)3-1-4-11(12)22-14(13)15(21)19-5-2-7-20-8-6-18-9-20/h1,3-4,6,8-9H,2,5,7H2,(H,19,21) |
| InChIKey | WFGSMGOBPKPFHM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|