C11H23N3O — CID 2970758
3,3-dimethyl-N-(4-methylpiperazin-1-yl)butanamide (PubChem CID 2970758) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3,3-dimethyl-N-(4-methylpiperazin-1-yl)butanamide.
| Compound Name | 3,3-dimethyl-N-(4-methylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 2970758 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3,3-dimethyl-N-(4-methylpiperazin-1-yl)butanamide |
| SMILES | CN1CCN(NC(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C11H23N3O/c1-11(2,3)9-10(15)12-14-7-5-13(4)6-8-14/h5-9H2,1-4H3,(H,12,15) |
| InChIKey | JQMDWIRYDJGZHR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |