C17H15Cl2N3O3 — CID 2970834
(3,5-dichlorophenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 2970834) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dichlorophenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2970834 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (3,5-dichlorophenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H15Cl2N3O3/c18-13-9-12(10-14(19)11-13)17(23)21-7-5-20(6-8-21)15-1-3-16(4-2-15)22(24)25/h1-4,9-11H,5-8H2 |
| InChIKey | VMAYLIFDHBGYDX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|