C10H8N2O2S2 — CID 2971411
2-(thiophene-2-carbonylamino)thiophene-3-carboxamide (PubChem CID 2971411) has the molecular formula C10H8N2O2S2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-(thiophene-2-carbonylamino)thiophene-3-carboxamide.
| Compound Name | 2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2971411 |
| Molecular Formula | C10H8N2O2S2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C10H8N2O2S2/c11-8(13)6-3-5-16-10(6)12-9(14)7-2-1-4-15-7/h1-5H,(H2,11,13)(H,12,14) |
| InChIKey | OEIOSAFYCBYSPX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |