About (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone
(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone (PubChem CID 2971466) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone.
Molecular Properties
| Compound Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone |
| PubChem CID | 2971466 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)c1cc(C)on1 |
| InChI | InChI=1S/C15H16N2O2/c1-10-5-6-14-12(8-10)4-3-7-17(14)15(18)13-9-11(2)19-16-13/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | XUEDPRWQSGPJNA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
The IUPAC name of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone (CID 2971466) is (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone.
What is the SMILES notation for (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
The canonical SMILES for (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone is Cc1ccc2c(c1)CCCN2C(=O)c1cc(C)on1.
What is the InChIKey of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
The InChIKey is XUEDPRWQSGPJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-10-5-6-14-12(8-10)4-3-7-17(14)15(18)13-9-11(2)19-16-13/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone has a molecular weight of 256.31 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone is sourced from PubChem (CID 2971466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).