C16H19NOS — CID 2971490
N-[1-(3,4-dimethylphenyl)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 2971490) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 2971490 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1ccc(C(C)NC(=O)Cc2cccs2)cc1C |
| InChI | InChI=1S/C16H19NOS/c1-11-6-7-14(9-12(11)2)13(3)17-16(18)10-15-5-4-8-19-15/h4-9,13H,10H2,1-3H3,(H,17,18) |
| InChIKey | DNUIWUTXGKSBEY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |