About 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate
2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate (PubChem CID 2971605) has the molecular formula C18H28N2O4
and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate.
Molecular Properties
| Compound Name | 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate |
| PubChem CID | 2971605 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate |
| SMILES | CCC(COC(=O)Nc1cccc(C)c1C)NC(=O)OCC(C)C |
| InChI | InChI=1S/C18H28N2O4/c1-6-15(19-17(21)23-10-12(2)3)11-24-18(22)20-16-9-7-8-13(4)14(16)5/h7-9,12,15H,6,10-11H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | FZOQNKPLWGEAQZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate?
The IUPAC name of 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate (CID 2971605) is 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate.
What is the SMILES notation for 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate?
The canonical SMILES for 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate is CCC(COC(=O)Nc1cccc(C)c1C)NC(=O)OCC(C)C.
What is the InChIKey of 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate?
The InChIKey is FZOQNKPLWGEAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O4/c1-6-15(19-17(21)23-10-12(2)3)11-24-18(22)20-16-9-7-8-13(4)14(16)5/h7-9,12,15H,6,10-11H2,1-5H3,(H,19,21)(H,20,22).
What are the key properties of 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate?
2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate has a molecular weight of 336.43 g/mol, XLogP of 4.01, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropoxycarbonylamino)butyl N-(2,3-dimethylphenyl)carbamate is sourced from PubChem (CID 2971605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).