C10H11N7O4 — CID 2971678
4-amino-N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 2971678) has the molecular formula C10H11N7O4 and a molecular weight of 293.24 g/mol. Its IUPAC name is 4-amino-N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 2971678 |
| Molecular Formula | C10H11N7O4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-amino-N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Nc1nonc1C(=O)NCCNc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N7O4/c11-8-7(15-21-16-8)10(18)14-5-4-13-9-6(17(19)20)2-1-3-12-9/h1-3H,4-5H2,(H2,11,16)(H,12,13)(H,14,18) |
| InChIKey | WGADKKZHEGLBKM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 162.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|