C16H12F6N4O2S — CID 2971906
1-(2-phenylethyl)-2-sulfanylidene-5,5-bis(trifluoromethyl)-6,8-dihydropyrimido[4,5-d]pyrimidine-4,7-dione (PubChem CID 2971906) has the molecular formula C16H12F6N4O2S and a molecular weight of 438.35 g/mol. Its IUPAC name is 1-(2-phenylethyl)-2-sulfanylidene-5,5-bis(trifluoromethyl)-6,8-dihydropyrimido[4,5-d]pyrimidine-4,7-dione.
| Compound Name | 1-(2-phenylethyl)-2-sulfanylidene-5,5-bis(trifluoromethyl)-6,8-dihydropyrimido[4,5-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 2971906 |
| Molecular Formula | C16H12F6N4O2S |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1-(2-phenylethyl)-2-sulfanylidene-5,5-bis(trifluoromethyl)-6,8-dihydropyrimido[4,5-d]pyrimidine-4,7-dione |
| SMILES | O=C1Nc2c(c(=O)[nH]c(=S)n2CCc2ccccc2)C(C(F)(F)F)(C(F)(F)F)N1 |
| InChI | InChI=1S/C16H12F6N4O2S/c17-15(18,19)14(16(20,21)22)9-10(23-12(28)25-14)26(13(29)24-11(9)27)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,23,25,28)(H,24,27,29) |
| InChIKey | AVDXQIWNRZBSPR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|