C7H9NO2 — CID 2972
3-hydroxy-1,2-dimethylpyridin-4-one (PubChem CID 2972) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-hydroxy-1,2-dimethylpyridin-4-one.
| Compound Name | 3-hydroxy-1,2-dimethylpyridin-4-one |
|---|---|
| PubChem CID | 2972 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-hydroxy-1,2-dimethylpyridin-4-one |
| SMILES | Cc1c(O)c(=O)ccn1C |
| InChI | InChI=1S/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 |
| InChIKey | TZXKOCQBRNJULO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |