About N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride
N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride (PubChem CID 2972044) has the molecular formula C11H16ClN3S
and a molecular weight of 257.79 g/mol. Its IUPAC name is N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 2972044 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| SMILES | CCN(CC)c1ncnc2sc(C)cc12.Cl |
| InChI | InChI=1S/C11H15N3S.ClH/c1-4-14(5-2)10-9-6-8(3)15-11(9)13-7-12-10;/h6-7H,4-5H2,1-3H3;1H |
| InChIKey | AUUDLOFYLKJILK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride (CID 2972044) is N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride is CCN(CC)c1ncnc2sc(C)cc12.Cl.
What is the InChIKey of N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is AUUDLOFYLKJILK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3S.ClH/c1-4-14(5-2)10-9-6-8(3)15-11(9)13-7-12-10;/h6-7H,4-5H2,1-3H3;1H.
What are the key properties of N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 257.79 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-6-methylthieno[2,3-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 2972044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).