C24H28N4O4S — CID 2972063
4-methoxy-N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 2972063) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-methoxy-N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 2972063 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-methoxy-N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCCOc2ccc(OC)cc2)nnc1C(C)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-5-14-28-22(17(2)25-23(29)18-6-8-19(30-3)9-7-18)26-27-24(28)33-16-15-32-21-12-10-20(31-4)11-13-21/h5-13,17H,1,14-16H2,2-4H3,(H,25,29) |
| InChIKey | BOUSZPHIANJCJR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|