About 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride
2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride (PubChem CID 2972188) has the molecular formula C16H18ClN5
and a molecular weight of 315.81 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride |
| PubChem CID | 2972188 |
| Molecular Formula | C16H18ClN5 |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride |
| SMILES | CN(C)c1ccc(Nc2nc(N)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C16H17N5.ClH/c1-21(2)12-9-7-11(8-10-12)18-16-19-14-6-4-3-5-13(14)15(17)20-16;/h3-10H,1-2H3,(H3,17,18,19,20);1H |
| InChIKey | QOCBEHHYUJMWGW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride?
The IUPAC name of 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride (CID 2972188) is 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride.
What is the SMILES notation for 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride?
The canonical SMILES for 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride is CN(C)c1ccc(Nc2nc(N)c3ccccc3n2)cc1.Cl.
What is the InChIKey of 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride?
The InChIKey is QOCBEHHYUJMWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5.ClH/c1-21(2)12-9-7-11(8-10-12)18-16-19-14-6-4-3-5-13(14)15(17)20-16;/h3-10H,1-2H3,(H3,17,18,19,20);1H.
What are the key properties of 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride?
2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride has a molecular weight of 315.81 g/mol, XLogP of 3.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[4-(dimethylamino)phenyl]quinazoline-2,4-diamine;hydrochloride is sourced from PubChem (CID 2972188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).