C18H21N5O2S — CID 2972530
N-[[4-(dimethylamino)phenyl]methyl]-2-methylsulfonyl-5-phenyl-1,2,4-triazol-3-amine (PubChem CID 2972530) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-methylsulfonyl-5-phenyl-1,2,4-triazol-3-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-methylsulfonyl-5-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 2972530 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-methylsulfonyl-5-phenyl-1,2,4-triazol-3-amine |
| SMILES | CN(C)c1ccc(CNc2nc(-c3ccccc3)nn2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21N5O2S/c1-22(2)16-11-9-14(10-12-16)13-19-18-20-17(15-7-5-4-6-8-15)21-23(18)26(3,24)25/h4-12H,13H2,1-3H3,(H,19,20,21) |
| InChIKey | HGLHTVNRTOVBTR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|