About 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide
3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 2972740) has the molecular formula C16H20N2O4S2
and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide |
| PubChem CID | 2972740 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C)c(NS(C)(=O)=O)c1C |
| InChI | InChI=1S/C16H20N2O4S2/c1-11-7-5-6-8-14(11)17-24(21,22)15-10-9-12(2)16(13(15)3)18-23(4,19)20/h5-10,17-18H,1-4H3 |
| InChIKey | ALTVJKJFTGQOFY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide?
The IUPAC name of 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide (CID 2972740) is 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide.
What is the SMILES notation for 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide?
The canonical SMILES for 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide is Cc1ccccc1NS(=O)(=O)c1ccc(C)c(NS(C)(=O)=O)c1C.
What is the InChIKey of 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide?
The InChIKey is ALTVJKJFTGQOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4S2/c1-11-7-5-6-8-14(11)17-24(21,22)15-10-9-12(2)16(13(15)3)18-23(4,19)20/h5-10,17-18H,1-4H3.
What are the key properties of 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide?
3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide has a molecular weight of 368.48 g/mol, XLogP of 2.78, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methanesulfonamido)-2,4-dimethyl-N-(2-methylphenyl)benzenesulfonamide is sourced from PubChem (CID 2972740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).