C23H19ClN2O5 — CID 2972854
methyl 2-[[3-[[2-(2-chlorophenoxy)acetyl]amino]benzoyl]amino]benzoate (PubChem CID 2972854) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is methyl 2-[[3-[[2-(2-chlorophenoxy)acetyl]amino]benzoyl]amino]benzoate.
| Compound Name | methyl 2-[[3-[[2-(2-chlorophenoxy)acetyl]amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 2972854 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | methyl 2-[[3-[[2-(2-chlorophenoxy)acetyl]amino]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cccc(NC(=O)COc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H19ClN2O5/c1-30-23(29)17-9-2-4-11-19(17)26-22(28)15-7-6-8-16(13-15)25-21(27)14-31-20-12-5-3-10-18(20)24/h2-13H,14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | VDCQOTKECXJWJN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |