About 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone
1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone (PubChem CID 2973409) has the molecular formula C16H22N2O3S
and a molecular weight of 322.40 g/mol. Its IUPAC name is [1-(benzenesulfonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone |
| PubChem CID | 2973409 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [1-(benzenesulfonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone |
| SMILES | C1CCN(CC1)C(=O)C2CCCN2S(=O)(=O)C3=CC=CC=C3 |
| InChI | InChI=1S/C16H22N2O3S/c19-16(17-11-5-2-6-12-17)15-10-7-13-18(15)22(20,21)14-8-3-1-4-9-14/h1,3-4,8-9,15H,2,5-7,10-13H2 |
| InChIKey | LTUSQGOQQCNPCZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 488 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone?
The IUPAC name of 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone (CID 2973409) is [1-(benzenesulfonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone?
The canonical SMILES for 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone is C1CCN(CC1)C(=O)C2CCCN2S(=O)(=O)C3=CC=CC=C3.
What is the InChIKey of 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone?
The InChIKey is LTUSQGOQQCNPCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3S/c19-16(17-11-5-2-6-12-17)15-10-7-13-18(15)22(20,21)14-8-3-1-4-9-14/h1,3-4,8-9,15H,2,5-7,10-13H2.
What are the key properties of 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone?
1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone has a molecular weight of 322.40 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(Phenylsulfonyl)pyrrolidin-2-yl piperidyl ketone is sourced from PubChem (CID 2973409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).