About N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide
N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide (PubChem CID 2973563) has the molecular formula C14H22N2O4S2
and a molecular weight of 346.47 g/mol. Its IUPAC name is N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide |
| PubChem CID | 2973563 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)c(C)c1NS(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O4S2/c1-11-7-8-13(12(2)14(11)15-21(3,17)18)22(19,20)16-9-5-4-6-10-16/h7-8,15H,4-6,9-10H2,1-3H3 |
| InChIKey | JKFGZYHQBWPQOH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide?
The IUPAC name of N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide (CID 2973563) is N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide.
What is the SMILES notation for N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide?
The canonical SMILES for N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide is Cc1ccc(S(=O)(=O)N2CCCCC2)c(C)c1NS(C)(=O)=O.
What is the InChIKey of N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide?
The InChIKey is JKFGZYHQBWPQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O4S2/c1-11-7-8-13(12(2)14(11)15-21(3,17)18)22(19,20)16-9-5-4-6-10-16/h7-8,15H,4-6,9-10H2,1-3H3.
What are the key properties of N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide?
N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide has a molecular weight of 346.47 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethyl-3-piperidin-1-ylsulfonylphenyl)methanesulfonamide is sourced from PubChem (CID 2973563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).