About 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine (PubChem CID 2973604) has the molecular formula C15H17FN2OS
and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine |
| PubChem CID | 2973604 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2nc(-c3ccc(F)cc3)cs2)CC(C)O1 |
| InChI | InChI=1S/C15H17FN2OS/c1-10-7-18(8-11(2)19-10)15-17-14(9-20-15)12-3-5-13(16)6-4-12/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | MUROXLDNBJXKAX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine?
The IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine (CID 2973604) is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine.
What is the SMILES notation for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine?
The canonical SMILES for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine is CC1CN(c2nc(-c3ccc(F)cc3)cs2)CC(C)O1.
What is the InChIKey of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine?
The InChIKey is MUROXLDNBJXKAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2OS/c1-10-7-18(8-11(2)19-10)15-17-14(9-20-15)12-3-5-13(16)6-4-12/h3-6,9-11H,7-8H2,1-2H3.
What are the key properties of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine?
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine has a molecular weight of 292.38 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2,6-dimethylmorpholine is sourced from PubChem (CID 2973604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).