About 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide
2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide (PubChem CID 2974193) has the molecular formula C18H29N3O4S
and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide.
Molecular Properties
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide |
| PubChem CID | 2974193 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide |
| SMILES | CCCNC(=O)CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)NCCC |
| InChI | InChI=1S/C18H29N3O4S/c1-4-12-19-17(22)11-10-16(18(23)20-13-5-2)21-26(24,25)15-8-6-14(3)7-9-15/h6-9,16,21H,4-5,10-13H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | UAGLXGPTHWMFPB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide?
The IUPAC name of 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide (CID 2974193) is 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide.
What is the SMILES notation for 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide?
The canonical SMILES for 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide is CCCNC(=O)CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)NCCC.
What is the InChIKey of 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide?
The InChIKey is UAGLXGPTHWMFPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O4S/c1-4-12-19-17(22)11-10-16(18(23)20-13-5-2)21-26(24,25)15-8-6-14(3)7-9-15/h6-9,16,21H,4-5,10-13H2,1-3H3,(H,19,22)(H,20,23).
What are the key properties of 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide?
2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide has a molecular weight of 383.51 g/mol, XLogP of 1.47, 11 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide is sourced from PubChem (CID 2974193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).