C16H14F4N2O5S — CID 2974389
3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide (PubChem CID 2974389) has the molecular formula C16H14F4N2O5S and a molecular weight of 422.36 g/mol. Its IUPAC name is 3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2974389 |
| Molecular Formula | C16H14F4N2O5S |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3-nitro-N-[4-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2ccc(COCC(F)(F)C(F)F)cc2)c1 |
| InChI | InChI=1S/C16H14F4N2O5S/c17-15(18)16(19,20)10-27-9-11-4-6-12(7-5-11)21-28(25,26)14-3-1-2-13(8-14)22(23)24/h1-8,15,21H,9-10H2 |
| InChIKey | PKDPLSJTUVEFDJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|