About N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide
N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 2974492) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| PubChem CID | 2974492 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)NC3CCCC3)(CC1=O)C2(C)C |
| InChI | InChI=1S/C16H25NO2/c1-14(2)15(3)8-9-16(14,10-12(15)18)13(19)17-11-6-4-5-7-11/h11H,4-10H2,1-3H3,(H,17,19) |
| InChIKey | UCEYPXUDZFDONN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide?
The IUPAC name of N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide (CID 2974492) is N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide.
What is the SMILES notation for N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide?
The canonical SMILES for N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide is CC12CCC(C(=O)NC3CCCC3)(CC1=O)C2(C)C.
What is the InChIKey of N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide?
The InChIKey is UCEYPXUDZFDONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-14(2)15(3)8-9-16(14,10-12(15)18)13(19)17-11-6-4-5-7-11/h11H,4-10H2,1-3H3,(H,17,19).
What are the key properties of N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide?
N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide has a molecular weight of 263.38 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxamide is sourced from PubChem (CID 2974492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).