About 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide
2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide (PubChem CID 2974652) has the molecular formula C18H18ClN3O2
and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide |
| PubChem CID | 2974652 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide |
| SMILES | CCn1c(=O)n(CC)c2cc(NC(=O)c3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C18H18ClN3O2/c1-3-21-15-10-9-12(11-16(15)22(4-2)18(21)24)20-17(23)13-7-5-6-8-14(13)19/h5-11H,3-4H2,1-2H3,(H,20,23) |
| InChIKey | VARFAHJSFDAJAF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide?
The IUPAC name of 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide (CID 2974652) is 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide.
What is the SMILES notation for 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide?
The canonical SMILES for 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide is CCn1c(=O)n(CC)c2cc(NC(=O)c3ccccc3Cl)ccc21.
What is the InChIKey of 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide?
The InChIKey is VARFAHJSFDAJAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN3O2/c1-3-21-15-10-9-12(11-16(15)22(4-2)18(21)24)20-17(23)13-7-5-6-8-14(13)19/h5-11H,3-4H2,1-2H3,(H,20,23).
What are the key properties of 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide?
2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide has a molecular weight of 343.81 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1,3-diethyl-2-oxobenzimidazol-5-yl)benzamide is sourced from PubChem (CID 2974652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).