C23H26N4O2S2 — CID 2975073
1-N,4-N-bis(4-acetylphenyl)-2-methylpiperazine-1,4-dicarbothioamide (PubChem CID 2975073) has the molecular formula C23H26N4O2S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-N,4-N-bis(4-acetylphenyl)-2-methylpiperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,4-N-bis(4-acetylphenyl)-2-methylpiperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 2975073 |
| Molecular Formula | C23H26N4O2S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-N,4-N-bis(4-acetylphenyl)-2-methylpiperazine-1,4-dicarbothioamide |
| SMILES | CC(=O)c1ccc(NC(=S)N2CCN(C(=S)Nc3ccc(C(C)=O)cc3)C(C)C2)cc1 |
| InChI | InChI=1S/C23H26N4O2S2/c1-15-14-26(22(30)24-20-8-4-18(5-9-20)16(2)28)12-13-27(15)23(31)25-21-10-6-19(7-11-21)17(3)29/h4-11,15H,12-14H2,1-3H3,(H,24,30)(H,25,31) |
| InChIKey | ZKYXVFYXPUCHBK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|