About furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate
furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 2975271) has the molecular formula C17H19NO5S
and a molecular weight of 349.41 g/mol. Its IUPAC name is furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| PubChem CID | 2975271 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)OCc2ccco2)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-13-6-8-15(9-7-13)24(20,21)18-10-2-5-16(18)17(19)23-12-14-4-3-11-22-14/h3-4,6-9,11,16H,2,5,10,12H2,1H3 |
| InChIKey | KUPVVXVYGAGKNR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
The IUPAC name of furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (CID 2975271) is furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
What is the SMILES notation for furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
The canonical SMILES for furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate is Cc1ccc(S(=O)(=O)N2CCCC2C(=O)OCc2ccco2)cc1.
What is the InChIKey of furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
The InChIKey is KUPVVXVYGAGKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO5S/c1-13-6-8-15(9-7-13)24(20,21)18-10-2-5-16(18)17(19)23-12-14-4-3-11-22-14/h3-4,6-9,11,16H,2,5,10,12H2,1H3.
What are the key properties of furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate has a molecular weight of 349.41 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate is sourced from PubChem (CID 2975271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).