C20H26ClN3O5S2 — CID 2975660
2-(4-chloro-N-methylsulfonylanilino)-N-[4-(diethylsulfamoyl)phenyl]propanamide (PubChem CID 2975660) has the molecular formula C20H26ClN3O5S2 and a molecular weight of 488.03 g/mol. Its IUPAC name is 2-(4-chloro-N-methylsulfonylanilino)-N-[4-(diethylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-(4-chloro-N-methylsulfonylanilino)-N-[4-(diethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 2975660 |
| Molecular Formula | C20H26ClN3O5S2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-(4-chloro-N-methylsulfonylanilino)-N-[4-(diethylsulfamoyl)phenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)C(C)N(c2ccc(Cl)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H26ClN3O5S2/c1-5-23(6-2)31(28,29)19-13-9-17(10-14-19)22-20(25)15(3)24(30(4,26)27)18-11-7-16(21)8-12-18/h7-15H,5-6H2,1-4H3,(H,22,25) |
| InChIKey | YONSQEWUCBAFFS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |