About 6-nitro-2,3-dihydro-1H-indole
6-nitro-2,3-dihydro-1H-indole (PubChem CID 29757) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 6-nitro-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-nitro-2,3-dihydro-1H-indole |
| PubChem CID | 29757 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 6-nitro-2,3-dihydro-1H-indole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C8H8N2O2/c11-10(12)7-2-1-6-3-4-9-8(6)5-7/h1-2,5,9H,3-4H2 |
| InChIKey | LTNYDSMDSLOMSM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-2,3-dihydro-1H-indole?
The IUPAC name of 6-nitro-2,3-dihydro-1H-indole (CID 29757) is 6-nitro-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-nitro-2,3-dihydro-1H-indole?
The canonical SMILES for 6-nitro-2,3-dihydro-1H-indole is O=[N+]([O-])c1ccc2c(c1)NCC2.
What is the InChIKey of 6-nitro-2,3-dihydro-1H-indole?
The InChIKey is LTNYDSMDSLOMSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-10(12)7-2-1-6-3-4-9-8(6)5-7/h1-2,5,9H,3-4H2.
What are the key properties of 6-nitro-2,3-dihydro-1H-indole?
6-nitro-2,3-dihydro-1H-indole has a molecular weight of 164.16 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-2,3-dihydro-1H-indole is sourced from PubChem (CID 29757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).