About 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide
3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide (PubChem CID 2975709) has the molecular formula C18H19NO5S
and a molecular weight of 361.42 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide.
Molecular Properties
| Compound Name | 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide |
| PubChem CID | 2975709 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H19NO5S/c20-18(8-11-25(21,22)13-14-4-2-1-3-5-14)19-15-6-7-16-17(12-15)24-10-9-23-16/h1-7,12H,8-11,13H2,(H,19,20) |
| InChIKey | NVYNPULBQSFGOC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide?
The IUPAC name of 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide (CID 2975709) is 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide.
What is the SMILES notation for 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide?
The canonical SMILES for 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide is O=C(CCS(=O)(=O)Cc1ccccc1)Nc1ccc2c(c1)OCCO2.
What is the InChIKey of 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide?
The InChIKey is NVYNPULBQSFGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5S/c20-18(8-11-25(21,22)13-14-4-2-1-3-5-14)19-15-6-7-16-17(12-15)24-10-9-23-16/h1-7,12H,8-11,13H2,(H,19,20).
What are the key properties of 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide?
3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide has a molecular weight of 361.42 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide is sourced from PubChem (CID 2975709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).