About 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide
3-ethoxy-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 2975744) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide |
| PubChem CID | 2975744 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CCOCCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-2-12-5-3-7(11)10-8-9-4-6-13-8/h4,6H,2-3,5H2,1H3,(H,9,10,11) |
| InChIKey | NDASSKUJRREWTE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide?
The IUPAC name of 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide (CID 2975744) is 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide.
What is the SMILES notation for 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide?
The canonical SMILES for 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide is CCOCCC(=O)Nc1nccs1.
What is the InChIKey of 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide?
The InChIKey is NDASSKUJRREWTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-2-12-5-3-7(11)10-8-9-4-6-13-8/h4,6H,2-3,5H2,1H3,(H,9,10,11).
What are the key properties of 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide?
3-ethoxy-N-(1,3-thiazol-2-yl)propanamide has a molecular weight of 200.26 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N-(1,3-thiazol-2-yl)propanamide is sourced from PubChem (CID 2975744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).