About 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride
2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride (PubChem CID 2975866) has the molecular formula C16H17ClN4
and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride |
| PubChem CID | 2975866 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(N)c3ccccc3n2)cc1C.Cl |
| InChI | InChI=1S/C16H16N4.ClH/c1-10-7-8-12(9-11(10)2)18-16-19-14-6-4-3-5-13(14)15(17)20-16;/h3-9H,1-2H3,(H3,17,18,19,20);1H |
| InChIKey | UEKHRWFIPHUAAM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride?
The IUPAC name of 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride (CID 2975866) is 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride.
What is the SMILES notation for 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride?
The canonical SMILES for 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride is Cc1ccc(Nc2nc(N)c3ccccc3n2)cc1C.Cl.
What is the InChIKey of 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride?
The InChIKey is UEKHRWFIPHUAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4.ClH/c1-10-7-8-12(9-11(10)2)18-16-19-14-6-4-3-5-13(14)15(17)20-16;/h3-9H,1-2H3,(H3,17,18,19,20);1H.
What are the key properties of 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride?
2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride has a molecular weight of 300.79 g/mol, XLogP of 3.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3,4-dimethylphenyl)quinazoline-2,4-diamine;hydrochloride is sourced from PubChem (CID 2975866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).