C23H24FN5O3S — CID 2976094
2-fluoro-N-[2-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 2976094) has the molecular formula C23H24FN5O3S and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-fluoro-N-[2-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 2976094 |
| Molecular Formula | C23H24FN5O3S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-fluoro-N-[2-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(CCNC(=O)c2ccccc2F)nnc1SCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H24FN5O3S/c1-3-14-29-20(12-13-25-22(31)18-6-4-5-7-19(18)24)27-28-23(29)33-15-21(30)26-16-8-10-17(32-2)11-9-16/h3-11H,1,12-15H2,2H3,(H,25,31)(H,26,30) |
| InChIKey | IESHSPRPHQSQDW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|