C13H18F3NO2 — CID 2977000
1-[3-[3-(trifluoromethyl)phenoxy]propylamino]propan-2-ol (PubChem CID 2977000) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-[3-[3-(trifluoromethyl)phenoxy]propylamino]propan-2-ol.
| Compound Name | 1-[3-[3-(trifluoromethyl)phenoxy]propylamino]propan-2-ol |
|---|---|
| PubChem CID | 2977000 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-[3-[3-(trifluoromethyl)phenoxy]propylamino]propan-2-ol |
| SMILES | CC(O)CNCCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO2/c1-10(18)9-17-6-3-7-19-12-5-2-4-11(8-12)13(14,15)16/h2,4-5,8,10,17-18H,3,6-7,9H2,1H3 |
| InChIKey | DVUCTEYNXCVVHW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|