C23H27N3O3 — CID 2977160
4-butoxy-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylbenzamide (PubChem CID 2977160) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-butoxy-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-butoxy-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 2977160 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-butoxy-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2nc(-c3ccccc3)no2)C(C)C)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-4-5-15-28-20-13-11-19(12-14-20)23(27)26(17(2)3)16-21-24-22(25-29-21)18-9-7-6-8-10-18/h6-14,17H,4-5,15-16H2,1-3H3 |
| InChIKey | FPUZGQDDYOOCFG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|